[1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride

C11H22ClNO2 — CID 10776156

IUPAC[1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride
SMILESCC1(C)CCC(C[NH3+])(CC(=O)O)CC1.[Cl-]
InChIInChI=1S/C11H21NO2.ClH/c1-10(2)3-5-11(8-12,6-4-10)7-9(13)14;/h3-8,12H2,1-2H3,(H,13,14);1H
InChIKeyOYEFRZQXISXTDC-UHFFFAOYSA-N
MW235.75 g/mol
LogP-1.71
Rot. Bonds3

About [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride

[1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride (PubChem CID 10776156) has the molecular formula C11H22ClNO2 and a molecular weight of 235.75 g/mol. Its IUPAC name is [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride.

Molecular Properties

Compound Name[1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride
PubChem CID10776156
Molecular FormulaC11H22ClNO2
Molecular Weight235.75 g/mol
Exact Mass235.13
IUPAC Name[1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride
SMILESCC1(C)CCC(C[NH3+])(CC(=O)O)CC1.[Cl-]
InChIInChI=1S/C11H21NO2.ClH/c1-10(2)3-5-11(8-12,6-4-10)7-9(13)14;/h3-8,12H2,1-2H3,(H,13,14);1H
InChIKeyOYEFRZQXISXTDC-UHFFFAOYSA-N
XLogP-1.71
TPSA64.94 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.75
LogP ≤ 5-1.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride?
The IUPAC name of [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride (CID 10776156) is [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride.
What is the SMILES notation for [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride?
The canonical SMILES for [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride is CC1(C)CCC(C[NH3+])(CC(=O)O)CC1.[Cl-].
What is the InChIKey of [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride?
The InChIKey is OYEFRZQXISXTDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2.ClH/c1-10(2)3-5-11(8-12,6-4-10)7-9(13)14;/h3-8,12H2,1-2H3,(H,13,14);1H.
What are the key properties of [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride?
[1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride has a molecular weight of 235.75 g/mol, XLogP of -1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(carboxymethyl)-4,4-dimethylcyclohexyl]methylazanium chloride is sourced from PubChem (CID 10776156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).