C11H18O2S — CID 114471353
2-[1-(3-methylbut-3-enylsulfanylmethyl)cyclopropyl]acetic acid (PubChem CID 114471353) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-[1-(3-methylbut-3-enylsulfanylmethyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(3-methylbut-3-enylsulfanylmethyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 114471353 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-[1-(3-methylbut-3-enylsulfanylmethyl)cyclopropyl]acetic acid |
| SMILES | C=C(C)CCSCC1(CC(=O)O)CC1 |
| InChI | InChI=1S/C11H18O2S/c1-9(2)3-6-14-8-11(4-5-11)7-10(12)13/h1,3-8H2,2H3,(H,12,13) |
| InChIKey | VHMSTNUNDZRSSW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|