About 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid
2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid (PubChem CID 65442124) has the molecular formula C8H12F2O2S
and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid.
Analyze 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid?
The IUPAC name of 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid (CID 65442124) is 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid is O=C(O)CC1(CSCC(F)F)CC1.
What is the InChIKey of 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid?
The InChIKey is GEOFEJOLKMGUBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2O2S/c9-6(10)4-13-5-8(1-2-8)3-7(11)12/h6H,1-5H2,(H,11,12).
What are the key properties of 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid?
2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid has a molecular weight of 210.24 g/mol, XLogP of 2.24, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,2-difluoroethylsulfanylmethyl)cyclopropyl]acetic acid is sourced from PubChem (CID 65442124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).