C10H18O3S — CID 65441692
2-[1-(4-hydroxybutylsulfanylmethyl)cyclopropyl]acetic acid (PubChem CID 65441692) has the molecular formula C10H18O3S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-[1-(4-hydroxybutylsulfanylmethyl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(4-hydroxybutylsulfanylmethyl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65441692 |
| Molecular Formula | C10H18O3S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 2-[1-(4-hydroxybutylsulfanylmethyl)cyclopropyl]acetic acid |
| SMILES | O=C(O)CC1(CSCCCCO)CC1 |
| InChI | InChI=1S/C10H18O3S/c11-5-1-2-6-14-8-10(3-4-10)7-9(12)13/h11H,1-8H2,(H,12,13) |
| InChIKey | GAIBZGHVXASSAB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|