About [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride
[(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride (PubChem CID 10656622) has the molecular formula C10H20ClNO2
and a molecular weight of 221.73 g/mol. Its IUPAC name is [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride.
Molecular Properties
| Compound Name | [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride |
| PubChem CID | 10656622 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride |
| SMILES | C[C@H]1CCCC[C@@]1(C[NH3+])CC(=O)O.[Cl-] |
| InChI | InChI=1S/C10H19NO2.ClH/c1-8-4-2-3-5-10(8,7-11)6-9(12)13;/h8H,2-7,11H2,1H3,(H,12,13);1H/t8-,10-;/m0./s1 |
| InChIKey | VUBFBBNAMKRADY-GNAZCLTHSA-N |
| XLogP | -2.10 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride?
The IUPAC name of [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride (CID 10656622) is [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride.
What is the SMILES notation for [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride?
The canonical SMILES for [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride is C[C@H]1CCCC[C@@]1(C[NH3+])CC(=O)O.[Cl-].
What is the InChIKey of [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride?
The InChIKey is VUBFBBNAMKRADY-GNAZCLTHSA-N. The full InChI is InChI=1S/C10H19NO2.ClH/c1-8-4-2-3-5-10(8,7-11)6-9(12)13;/h8H,2-7,11H2,1H3,(H,12,13);1H/t8-,10-;/m0./s1.
What are the key properties of [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride?
[(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride has a molecular weight of 221.73 g/mol, XLogP of -2.10, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-1-(carboxymethyl)-2-methylcyclohexyl]methylazanium chloride is sourced from PubChem (CID 10656622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).