C7H3F10NO2 — CID 174986049
1-amino-2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-carboxylic acid (PubChem CID 174986049) has the molecular formula C7H3F10NO2 and a molecular weight of 323.09 g/mol. Its IUPAC name is 1-amino-2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-carboxylic acid.
| Compound Name | 1-amino-2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 174986049 |
| Molecular Formula | C7H3F10NO2 |
| Molecular Weight | 323.09 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 1-amino-2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-carboxylic acid |
| SMILES | NC1(C(=O)O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H3F10NO2/c8-3(9)2(18,1(19)20)4(10,11)6(14,15)7(16,17)5(3,12)13/h18H2,(H,19,20) |
| InChIKey | VDQDXXVMVOSIOO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.09 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|