C13H5ClF11NO — CID 4078240
N-(3-chlorophenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide (PubChem CID 4078240) has the molecular formula C13H5ClF11NO and a molecular weight of 435.62 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4078240 |
| Molecular Formula | C13H5ClF11NO |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | N-(3-chlorophenyl)-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H5ClF11NO/c14-5-2-1-3-6(4-5)26-7(27)8(15)9(16,17)11(20,21)13(24,25)12(22,23)10(8,18)19/h1-4H,(H,26,27) |
| InChIKey | VMKMZNSTQMPQHW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|