C7H2F8O2 — CID 122459159
3a,4,4,5,5,6,6,6a-octafluoro-2-methylidenecyclopenta[d][1,3]dioxole (PubChem CID 122459159) has the molecular formula C7H2F8O2 and a molecular weight of 270.08 g/mol. Its IUPAC name is 3a,4,4,5,5,6,6,6a-octafluoro-2-methylidenecyclopenta[d][1,3]dioxole.
| Compound Name | 3a,4,4,5,5,6,6,6a-octafluoro-2-methylidenecyclopenta[d][1,3]dioxole |
|---|---|
| PubChem CID | 122459159 |
| Molecular Formula | C7H2F8O2 |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 3a,4,4,5,5,6,6,6a-octafluoro-2-methylidenecyclopenta[d][1,3]dioxole |
| SMILES | C=C1OC2(F)C(F)(F)C(F)(F)C(F)(F)C2(F)O1 |
| InChI | InChI=1S/C7H2F8O2/c1-2-16-6(14)4(10,11)3(8,9)5(12,13)7(6,15)17-2/h1H2 |
| InChIKey | NVPCZAPXNLMWPA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|