C8H6F4O2 — CID 145021961
5,6-bis(ethenyl)-2,2,3,3-tetrafluoro-1,4-dioxine (PubChem CID 145021961) has the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-2,2,3,3-tetrafluoro-1,4-dioxine.
| Compound Name | 5,6-bis(ethenyl)-2,2,3,3-tetrafluoro-1,4-dioxine |
|---|---|
| PubChem CID | 145021961 |
| Molecular Formula | C8H6F4O2 |
| Molecular Weight | 210.13 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 5,6-bis(ethenyl)-2,2,3,3-tetrafluoro-1,4-dioxine |
| SMILES | C=CC1=C(C=C)OC(F)(F)C(F)(F)O1 |
| InChI | InChI=1S/C8H6F4O2/c1-3-5-6(4-2)14-8(11,12)7(9,10)13-5/h3-4H,1-2H2 |
| InChIKey | CVJPEFFLTPVZMR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.13 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|