C5H3F5O2 — CID 19010971
2,2,3,3,5-pentafluoro-6-methyl-1,4-dioxine (PubChem CID 19010971) has the molecular formula C5H3F5O2 and a molecular weight of 190.07 g/mol. Its IUPAC name is 2,2,3,3,5-pentafluoro-6-methyl-1,4-dioxine.
| Compound Name | 2,2,3,3,5-pentafluoro-6-methyl-1,4-dioxine |
|---|---|
| PubChem CID | 19010971 |
| Molecular Formula | C5H3F5O2 |
| Molecular Weight | 190.07 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 2,2,3,3,5-pentafluoro-6-methyl-1,4-dioxine |
| SMILES | CC1=C(F)OC(F)(F)C(F)(F)O1 |
| InChI | InChI=1S/C5H3F5O2/c1-2-3(6)12-5(9,10)4(7,8)11-2/h1H3 |
| InChIKey | QQNRHUUSVOEQAX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.07 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|