C15H28 — CID 144553688
1,2-bis(ethenyl)-3,3-dimethylcyclopentene;ethane (PubChem CID 144553688) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-3,3-dimethylcyclopentene;ethane.
| Compound Name | 1,2-bis(ethenyl)-3,3-dimethylcyclopentene;ethane |
|---|---|
| PubChem CID | 144553688 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 1,2-bis(ethenyl)-3,3-dimethylcyclopentene;ethane |
| SMILES | C=CC1=C(C=C)C(C)(C)CC1.CC.CC |
| InChI | InChI=1S/C11H16.2C2H6/c1-5-9-7-8-11(3,4)10(9)6-2;2*1-2/h5-6H,1-2,7-8H2,3-4H3;2*1-2H3 |
| InChIKey | XCIKCJUQGFONGQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |