C11H15NO — CID 143603798
2,3-bis(ethenyl)-1-methylcyclopent-2-ene-1-carboxamide (PubChem CID 143603798) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1-methylcyclopent-2-ene-1-carboxamide.
| Compound Name | 2,3-bis(ethenyl)-1-methylcyclopent-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 143603798 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2,3-bis(ethenyl)-1-methylcyclopent-2-ene-1-carboxamide |
| SMILES | C=CC1=C(C=C)C(C)(C(N)=O)CC1 |
| InChI | InChI=1S/C11H15NO/c1-4-8-6-7-11(3,10(12)13)9(8)5-2/h4-5H,1-2,6-7H2,3H3,(H2,12,13) |
| InChIKey | AOGVHEACZLKPJN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |