C17H27N — CID 90201281
(9Z)-1-ethenyl-9-ethylidene-2,2,8,8-tetramethyl-3,4,6,7-tetrahydroquinolizine (PubChem CID 90201281) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is (9Z)-1-ethenyl-9-ethylidene-2,2,8,8-tetramethyl-3,4,6,7-tetrahydroquinolizine.
| Compound Name | (9Z)-1-ethenyl-9-ethylidene-2,2,8,8-tetramethyl-3,4,6,7-tetrahydroquinolizine |
|---|---|
| PubChem CID | 90201281 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | (9Z)-1-ethenyl-9-ethylidene-2,2,8,8-tetramethyl-3,4,6,7-tetrahydroquinolizine |
| SMILES | C=CC1=C2/C(=C\C)C(C)(C)CCN2CCC1(C)C |
| InChI | InChI=1S/C17H27N/c1-7-13-15-14(8-2)17(5,6)10-12-18(15)11-9-16(13,3)4/h7-8H,1,9-12H2,2-6H3/b14-8+ |
| InChIKey | QNMWIVMOYWKNHK-RIYZIHGNSA-N |
| XLogP | 4.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |