C10H5F10NO2 — CID 166647290
7,7,8,8,9,9,10,10,11,11-decafluoro-3-methylidene-1-oxa-5-azaspiro[5.5]undecan-4-one (PubChem CID 166647290) has the molecular formula C10H5F10NO2 and a molecular weight of 361.14 g/mol. Its IUPAC name is 7,7,8,8,9,9,10,10,11,11-decafluoro-3-methylidene-1-oxa-5-azaspiro[5.5]undecan-4-one.
| Compound Name | 7,7,8,8,9,9,10,10,11,11-decafluoro-3-methylidene-1-oxa-5-azaspiro[5.5]undecan-4-one |
|---|---|
| PubChem CID | 166647290 |
| Molecular Formula | C10H5F10NO2 |
| Molecular Weight | 361.14 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 7,7,8,8,9,9,10,10,11,11-decafluoro-3-methylidene-1-oxa-5-azaspiro[5.5]undecan-4-one |
| SMILES | C=C1COC2(NC1=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C10H5F10NO2/c1-3-2-23-10(21-4(3)22)8(17,18)6(13,14)5(11,12)7(15,16)9(10,19)20/h1-2H2,(H,21,22) |
| InChIKey | RCISXAJNVJRSAO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.14 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|