C4H5NO3 — CID 54534694
4-oxo-1,3-oxazolidine-2-carbaldehyde (PubChem CID 54534694) has the molecular formula C4H5NO3 and a molecular weight of 115.09 g/mol. Its IUPAC name is 4-oxo-1,3-oxazolidine-2-carbaldehyde.
| Compound Name | 4-oxo-1,3-oxazolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 54534694 |
| Molecular Formula | C4H5NO3 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.03 |
| IUPAC Name | 4-oxo-1,3-oxazolidine-2-carbaldehyde |
| SMILES | O=CC1NC(=O)CO1 |
| InChI | InChI=1S/C4H5NO3/c6-1-4-5-3(7)2-8-4/h1,4H,2H2,(H,5,7) |
| InChIKey | MJXJKLWCYICIBO-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|