C4H4Cl3NO2 — CID 95562008
(2S)-2-(trichloromethyl)-1,3-oxazolidin-4-one (PubChem CID 95562008) has the molecular formula C4H4Cl3NO2 and a molecular weight of 204.44 g/mol. Its IUPAC name is (2S)-2-(trichloromethyl)-1,3-oxazolidin-4-one.
| Compound Name | (2S)-2-(trichloromethyl)-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 95562008 |
| Molecular Formula | C4H4Cl3NO2 |
| Molecular Weight | 204.44 g/mol |
| Exact Mass | 202.93 |
| IUPAC Name | (2S)-2-(trichloromethyl)-1,3-oxazolidin-4-one |
| SMILES | O=C1CO[C@@H](C(Cl)(Cl)Cl)N1 |
| InChI | InChI=1S/C4H4Cl3NO2/c5-4(6,7)3-8-2(9)1-10-3/h3H,1H2,(H,8,9)/t3-/m0/s1 |
| InChIKey | CJQDVEAFPRJTCD-VKHMYHEASA-N |
| XLogP | 0.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|