C7H11NO5 — CID 175827998
7,8-dihydroxy-1,4a,6,7,8,8a-hexahydropyrano[2,3-b][1,4]oxazin-2-one (PubChem CID 175827998) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is 7,8-dihydroxy-1,4a,6,7,8,8a-hexahydropyrano[2,3-b][1,4]oxazin-2-one.
| Compound Name | 7,8-dihydroxy-1,4a,6,7,8,8a-hexahydropyrano[2,3-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 175827998 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 7,8-dihydroxy-1,4a,6,7,8,8a-hexahydropyrano[2,3-b][1,4]oxazin-2-one |
| SMILES | O=C1COC2OCC(O)C(O)C2N1 |
| InChI | InChI=1S/C7H11NO5/c9-3-1-12-7-5(6(3)11)8-4(10)2-13-7/h3,5-7,9,11H,1-2H2,(H,8,10) |
| InChIKey | QNYHGROOVROQHF-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |