C6H10O5 — CID 178051967
(4R,5S,6R,7S)-2,8-dioxabicyclo[3.2.1]octane-4,6,7-triol (PubChem CID 178051967) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. Its IUPAC name is (4R,5S,6R,7S)-2,8-dioxabicyclo[3.2.1]octane-4,6,7-triol.
| Compound Name | (4R,5S,6R,7S)-2,8-dioxabicyclo[3.2.1]octane-4,6,7-triol |
|---|---|
| PubChem CID | 178051967 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (4R,5S,6R,7S)-2,8-dioxabicyclo[3.2.1]octane-4,6,7-triol |
| SMILES | O[C@H]1[C@H]2OC(OC[C@H]2O)[C@H]1O |
| InChI | InChI=1S/C6H10O5/c7-2-1-10-6-4(9)3(8)5(2)11-6/h2-9H,1H2/t2-,3-,4+,5+,6?/m1/s1 |
| InChIKey | GYNYBVOAJFHCRG-QTVWNMPRSA-N |
| XLogP | -2.18 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |