C24H42O20 — CID 70940829
12,25-bis(hydroxymethyl)-2,9,11,15,22,24,29-heptaoxatetracyclo[21.3.1.13,7.110,14]nonacosane-4,5,6,13,17,18,19,20,26,27,28-undecol (PubChem CID 70940829) has the molecular formula C24H42O20 and a molecular weight of 650.58 g/mol. Its IUPAC name is 12,25-bis(hydroxymethyl)-2,9,11,15,22,24,29-heptaoxatetracyclo[21.3.1.13,7.110,14]nonacosane-4,5,6,13,17,18,19,20,26,27,28-undecol.
| Compound Name | 12,25-bis(hydroxymethyl)-2,9,11,15,22,24,29-heptaoxatetracyclo[21.3.1.13,7.110,14]nonacosane-4,5,6,13,17,18,19,20,26,27,28-undecol |
|---|---|
| PubChem CID | 70940829 |
| Molecular Formula | C24H42O20 |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 650.23 |
| IUPAC Name | 12,25-bis(hydroxymethyl)-2,9,11,15,22,24,29-heptaoxatetracyclo[21.3.1.13,7.110,14]nonacosane-4,5,6,13,17,18,19,20,26,27,28-undecol |
| SMILES | OCC1OC2OCC3OC(OC4C(O)C(CO)OC(OCC(O)C(O)C(O)C(O)COC(C1O)C2O)C4O)C(O)C(O)C3O |
| InChI | InChI=1S/C24H42O20/c25-1-8-14(32)20-18(36)22(41-8)40-5-10-13(31)16(34)17(35)24(43-10)44-21-15(33)9(2-26)42-23(19(21)37)39-4-7(28)12(30)11(29)6(27)3-38-20/h6-37H,1-5H2 |
| InChIKey | XECYBWYFPREOQS-UHFFFAOYSA-N |
| XLogP | -9.07 |
| TPSA | 327.60 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | -9.07 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 20 |