C6H10O4 — CID 134866326
(3R)-3-(hydroxymethyl)-2,6-dioxabicyclo[3.2.0]heptan-4-ol (PubChem CID 134866326) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (3R)-3-(hydroxymethyl)-2,6-dioxabicyclo[3.2.0]heptan-4-ol.
| Compound Name | (3R)-3-(hydroxymethyl)-2,6-dioxabicyclo[3.2.0]heptan-4-ol |
|---|---|
| PubChem CID | 134866326 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (3R)-3-(hydroxymethyl)-2,6-dioxabicyclo[3.2.0]heptan-4-ol |
| SMILES | OC[C@H]1OC2COC2C1O |
| InChI | InChI=1S/C6H10O4/c7-1-3-5(8)6-4(10-3)2-9-6/h3-8H,1-2H2/t3-,4?,5?,6?/m1/s1 |
| InChIKey | QYRVENKUFPCNRV-OMEINRLFSA-N |
| XLogP | -1.49 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |