C8H14O6 — CID 102475258
(3aR,5R,6S,7S,7aS)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2,6,7-triol (PubChem CID 102475258) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is (3aR,5R,6S,7S,7aS)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2,6,7-triol.
| Compound Name | (3aR,5R,6S,7S,7aS)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2,6,7-triol |
|---|---|
| PubChem CID | 102475258 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (3aR,5R,6S,7S,7aS)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2,6,7-triol |
| SMILES | OC[C@H]1O[C@@H]2CC(O)O[C@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14O6/c9-2-4-6(11)7(12)8-3(13-4)1-5(10)14-8/h3-12H,1-2H2/t3-,4-,5?,6-,7+,8-/m1/s1 |
| InChIKey | KKPFKLQYORIGJN-VXGBBXGKSA-N |
| XLogP | -2.42 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |