C9H17NO5 — CID 152930911
(3aR,6S)-2-(aminomethyl)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6,7-diol (PubChem CID 152930911) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is (3aR,6S)-2-(aminomethyl)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6,7-diol.
| Compound Name | (3aR,6S)-2-(aminomethyl)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6,7-diol |
|---|---|
| PubChem CID | 152930911 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (3aR,6S)-2-(aminomethyl)-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-6,7-diol |
| SMILES | NCC1C[C@H]2OC(CO)[C@@H](O)C(O)C2O1 |
| InChI | InChI=1S/C9H17NO5/c10-2-4-1-5-9(14-4)8(13)7(12)6(3-11)15-5/h4-9,11-13H,1-3,10H2/t4?,5-,6?,7-,8?,9?/m1/s1 |
| InChIKey | UKYIXANOHZVAPD-GDKSKUGFSA-N |
| XLogP | -2.42 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |