C10H18O7 — CID 163497744
2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;oxolane-3,4-diol (PubChem CID 163497744) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;oxolane-3,4-diol.
| Compound Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;oxolane-3,4-diol |
|---|---|
| PubChem CID | 163497744 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;oxolane-3,4-diol |
| SMILES | OC1COC2C(O)COC12.OC1COCC1O |
| InChI | InChI=1S/C6H10O4.C4H8O3/c7-3-1-9-6-4(8)2-10-5(3)6;5-3-1-7-2-4(3)6/h3-8H,1-2H2;3-6H,1-2H2 |
| InChIKey | CSDNDLMVPAJHBJ-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |