C10H16O5 — CID 66760272
(3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;ethenoxyethene (PubChem CID 66760272) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;ethenoxyethene.
| Compound Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;ethenoxyethene |
|---|---|
| PubChem CID | 66760272 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;ethenoxyethene |
| SMILES | C=COC=C.O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C6H10O4.C4H6O/c7-3-1-9-6-4(8)2-10-5(3)6;1-3-5-4-2/h3-8H,1-2H2;3-4H,1-2H2/t3-,4+,5-,6-;/m1./s1 |
| InChIKey | LBQVYTIARLVQGF-VFQQELCFSA-N |
| XLogP | -0.20 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|