C11H18O6 — CID 146313796
(3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;methyl 2-methylprop-2-enoate (PubChem CID 146313796) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;methyl 2-methylprop-2-enoate.
| Compound Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146313796 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C6H10O4.C5H8O2/c7-3-1-9-6-4(8)2-10-5(3)6;1-4(2)5(6)7-3/h3-8H,1-2H2;1H2,2-3H3/t3-,4+,5-,6-;/m1./s1 |
| InChIKey | HJMHOJRJBPMHIW-VFQQELCFSA-N |
| XLogP | -0.76 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|