C6H9NO4 — CID 134550950
(3aR,6R,6aR)-3-nitroso-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 134550950) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is (3aR,6R,6aR)-3-nitroso-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | (3aR,6R,6aR)-3-nitroso-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 134550950 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (3aR,6R,6aR)-3-nitroso-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | O=NC1CO[C@@H]2[C@H](O)CO[C@H]12 |
| InChI | InChI=1S/C6H9NO4/c8-4-2-11-5-3(7-9)1-10-6(4)5/h3-6,8H,1-2H2/t3?,4-,5-,6-/m1/s1 |
| InChIKey | FJRZYJHZTYZJKQ-YMFWUOAHSA-N |
| XLogP | -0.72 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |