C7H11ClO3 — CID 123503753
3-(chloromethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol (PubChem CID 123503753) has the molecular formula C7H11ClO3 and a molecular weight of 178.61 g/mol. Its IUPAC name is 3-(chloromethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol.
| Compound Name | 3-(chloromethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
|---|---|
| PubChem CID | 123503753 |
| Molecular Formula | C7H11ClO3 |
| Molecular Weight | 178.61 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 3-(chloromethyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol |
| SMILES | OC1COC2C(CCl)COC12 |
| InChI | InChI=1S/C7H11ClO3/c8-1-4-2-10-7-5(9)3-11-6(4)7/h4-7,9H,1-3H2 |
| InChIKey | WYUWZYPKQPNMDS-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.61 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|