C6H10O3 — CID 171562837
4-methyl-2,7-dioxabicyclo[4.1.0]heptan-5-ol (PubChem CID 171562837) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is 4-methyl-2,7-dioxabicyclo[4.1.0]heptan-5-ol.
| Compound Name | 4-methyl-2,7-dioxabicyclo[4.1.0]heptan-5-ol |
|---|---|
| PubChem CID | 171562837 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 4-methyl-2,7-dioxabicyclo[4.1.0]heptan-5-ol |
| SMILES | CC1COC2OC2C1O |
| InChI | InChI=1S/C6H10O3/c1-3-2-8-6-5(9-6)4(3)7/h3-7H,2H2,1H3 |
| InChIKey | PTVYBNIIOAAMPW-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|