C10H13NO6 — CID 159015800
5-(3,4,5-trihydroxyoxan-2-yl)-3H-pyridine-2,6-dione (PubChem CID 159015800) has the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. Its IUPAC name is 5-(3,4,5-trihydroxyoxan-2-yl)-3H-pyridine-2,6-dione.
| Compound Name | 5-(3,4,5-trihydroxyoxan-2-yl)-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 159015800 |
| Molecular Formula | C10H13NO6 |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 5-(3,4,5-trihydroxyoxan-2-yl)-3H-pyridine-2,6-dione |
| SMILES | O=C1CC=C(C2OCC(O)C(O)C2O)C(=O)N1 |
| InChI | InChI=1S/C10H13NO6/c12-5-3-17-9(8(15)7(5)14)4-1-2-6(13)11-10(4)16/h1,5,7-9,12,14-15H,2-3H2,(H,11,13,16) |
| InChIKey | JTBOZXUEZQGSCH-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|