C12H16FNO4 — CID 161221879
5-[(1S,2S,3R,4R)-2-fluoro-3-hydroxy-4-(hydroxymethyl)-2-methylcyclopentyl]-3H-pyridine-2,6-dione (PubChem CID 161221879) has the molecular formula C12H16FNO4 and a molecular weight of 257.26 g/mol. Its IUPAC name is 5-[(1S,2S,3R,4R)-2-fluoro-3-hydroxy-4-(hydroxymethyl)-2-methylcyclopentyl]-3H-pyridine-2,6-dione.
| Compound Name | 5-[(1S,2S,3R,4R)-2-fluoro-3-hydroxy-4-(hydroxymethyl)-2-methylcyclopentyl]-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 161221879 |
| Molecular Formula | C12H16FNO4 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 5-[(1S,2S,3R,4R)-2-fluoro-3-hydroxy-4-(hydroxymethyl)-2-methylcyclopentyl]-3H-pyridine-2,6-dione |
| SMILES | C[C@@]1(F)[C@H](O)[C@@H](CO)C[C@H]1C1=CCC(=O)NC1=O |
| InChI | InChI=1S/C12H16FNO4/c1-12(13)8(4-6(5-15)10(12)17)7-2-3-9(16)14-11(7)18/h2,6,8,10,15,17H,3-5H2,1H3,(H,14,16,18)/t6-,8+,10-,12+/m1/s1 |
| InChIKey | PWYANSZXBKXQPS-SDOWVZNUSA-N |
| XLogP | -0.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|