C8H15NO3 — CID 131201474
(5R,6S)-5-hydroxy-6-(hydroxymethyl)azocan-2-one (PubChem CID 131201474) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (5R,6S)-5-hydroxy-6-(hydroxymethyl)azocan-2-one.
| Compound Name | (5R,6S)-5-hydroxy-6-(hydroxymethyl)azocan-2-one |
|---|---|
| PubChem CID | 131201474 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (5R,6S)-5-hydroxy-6-(hydroxymethyl)azocan-2-one |
| SMILES | O=C1CC[C@@H](O)[C@H](CO)CCN1 |
| InChI | InChI=1S/C8H15NO3/c10-5-6-3-4-9-8(12)2-1-7(6)11/h6-7,10-11H,1-5H2,(H,9,12)/t6-,7+/m0/s1 |
| InChIKey | UJWNDIXCJZIPRO-NKWVEPMBSA-N |
| XLogP | -0.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |