C10H12N4O5 — CID 137224685
2-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-1,7-dihydropurin-6-one (PubChem CID 137224685) has the molecular formula C10H12N4O5 and a molecular weight of 268.23 g/mol. Its IUPAC name is 2-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-1,7-dihydropurin-6-one.
| Compound Name | 2-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-1,7-dihydropurin-6-one |
|---|---|
| PubChem CID | 137224685 |
| Molecular Formula | C10H12N4O5 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-1,7-dihydropurin-6-one |
| SMILES | O=c1[nH]c(C2OC[C@@H](O)[C@H](O)[C@H]2O)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H12N4O5/c15-3-1-19-7(6(17)5(3)16)9-13-8-4(10(18)14-9)11-2-12-8/h2-3,5-7,15-17H,1H2,(H2,11,12,13,14,18)/t3-,5+,6-,7?/m1/s1 |
| InChIKey | CAWUCEKLOMYXCU-KUVHAVBOSA-N |
| XLogP | -2.20 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |