C15H21N5O8 — CID 90470778
(3R,4R,5R)-2-[6-[[(3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]-7H-purin-2-yl]oxane-3,4,5-triol (PubChem CID 90470778) has the molecular formula C15H21N5O8 and a molecular weight of 399.36 g/mol. Its IUPAC name is (3R,4R,5R)-2-[6-[[(3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]-7H-purin-2-yl]oxane-3,4,5-triol.
| Compound Name | (3R,4R,5R)-2-[6-[[(3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]-7H-purin-2-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90470778 |
| Molecular Formula | C15H21N5O8 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (3R,4R,5R)-2-[6-[[(3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]amino]-7H-purin-2-yl]oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@H](O)COC(Nc2nc(C3OC[C@@H](O)[C@@H](O)[C@H]3O)nc3nc[nH]c23)[C@@H]1O |
| InChI | InChI=1S/C15H21N5O8/c21-4-1-27-11(9(25)7(4)23)14-18-12-6(16-3-17-12)13(19-14)20-15-10(26)8(24)5(22)2-28-15/h3-5,7-11,15,21-26H,1-2H2,(H2,16,17,18,19,20)/t4-,5-,7-,8-,9-,10-,11?,15?/m1/s1 |
| InChIKey | KCIRNRKNVCAULO-SBTAWOOFSA-N |
| XLogP | -3.64 |
| TPSA | 206.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |