C11H15N5O5 — CID 70184570
(2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(7H-purin-6-ylamino)oxane-3,4,5-triol (PubChem CID 70184570) has the molecular formula C11H15N5O5 and a molecular weight of 297.27 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(7H-purin-6-ylamino)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(7H-purin-6-ylamino)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70184570 |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-(hydroxymethyl)-6-(7H-purin-6-ylamino)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Nc2ncnc3nc[nH]c23)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15N5O5/c17-1-4-6(18)7(19)8(20)11(21-4)16-10-5-9(13-2-12-5)14-3-15-10/h2-4,6-8,11,17-20H,1H2,(H2,12,13,14,15,16)/t4-,6-,7+,8+,11-/m1/s1 |
| InChIKey | IQLWALDCMITDNX-RMBFFGPGSA-N |
| XLogP | -2.44 |
| TPSA | 156.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |