C21H27N7O6 — CID 176999426
(2S,3R)-2-amino-N-[(2R,4R,5S,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-(7H-purin-6-ylamino)oxan-3-yl]-3-(4-hydroxyphenyl)butanamide (PubChem CID 176999426) has the molecular formula C21H27N7O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is (2S,3R)-2-amino-N-[(2R,4R,5S,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-(7H-purin-6-ylamino)oxan-3-yl]-3-(4-hydroxyphenyl)butanamide.
| Compound Name | (2S,3R)-2-amino-N-[(2R,4R,5S,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-(7H-purin-6-ylamino)oxan-3-yl]-3-(4-hydroxyphenyl)butanamide |
|---|---|
| PubChem CID | 176999426 |
| Molecular Formula | C21H27N7O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (2S,3R)-2-amino-N-[(2R,4R,5S,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-(7H-purin-6-ylamino)oxan-3-yl]-3-(4-hydroxyphenyl)butanamide |
| SMILES | C[C@H](c1ccc(O)cc1)[C@H](N)C(=O)NC1[C@H](CO)O[C@H](Nc2ncnc3nc[nH]c23)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H27N7O6/c1-9(10-2-4-11(30)5-3-10)13(22)20(33)27-14-12(6-29)34-21(17(32)16(14)31)28-19-15-18(24-7-23-15)25-8-26-19/h2-5,7-9,12-14,16-17,21,29-32H,6,22H2,1H3,(H,27,33)(H2,23,24,25,26,28)/t9-,12+,13+,14?,16-,17+,21+/m1/s1 |
| InChIKey | CUYSMUKQXDWBAK-OYTLRYGCSA-N |
| XLogP | -1.47 |
| TPSA | 211.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |