C15H25N7O5 — CID 176999241
(3R)-2-amino-3-hydroxy-N-[(6S)-5-hydroxy-6-(7H-purin-6-ylamino)oxan-3-yl]butanamide;methanol (PubChem CID 176999241) has the molecular formula C15H25N7O5 and a molecular weight of 383.41 g/mol. Its IUPAC name is (3R)-2-amino-3-hydroxy-N-[(6S)-5-hydroxy-6-(7H-purin-6-ylamino)oxan-3-yl]butanamide;methanol.
| Compound Name | (3R)-2-amino-3-hydroxy-N-[(6S)-5-hydroxy-6-(7H-purin-6-ylamino)oxan-3-yl]butanamide;methanol |
|---|---|
| PubChem CID | 176999241 |
| Molecular Formula | C15H25N7O5 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (3R)-2-amino-3-hydroxy-N-[(6S)-5-hydroxy-6-(7H-purin-6-ylamino)oxan-3-yl]butanamide;methanol |
| SMILES | CO.C[C@@H](O)C(N)C(=O)NC1CO[C@H](Nc2ncnc3nc[nH]c23)C(O)C1 |
| InChI | InChI=1S/C14H21N7O4.CH4O/c1-6(22)9(15)13(24)20-7-2-8(23)14(25-3-7)21-12-10-11(17-4-16-10)18-5-19-12;1-2/h4-9,14,22-23H,2-3,15H2,1H3,(H,20,24)(H2,16,17,18,19,21);2H,1H3/t6-,7?,8?,9?,14+;/m1./s1 |
| InChIKey | OEEHROAXTHBIJJ-MJFCMMLOSA-N |
| XLogP | -2.33 |
| TPSA | 191.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |