C11H16N6O5S — CID 90906932
[(1R,2R,3S,4R)-2,3-dihydroxy-4-(7H-purin-6-ylamino)cyclopentyl]-methylsulfamic acid (PubChem CID 90906932) has the molecular formula C11H16N6O5S and a molecular weight of 344.35 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-2,3-dihydroxy-4-(7H-purin-6-ylamino)cyclopentyl]-methylsulfamic acid.
| Compound Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-(7H-purin-6-ylamino)cyclopentyl]-methylsulfamic acid |
|---|---|
| PubChem CID | 90906932 |
| Molecular Formula | C11H16N6O5S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [(1R,2R,3S,4R)-2,3-dihydroxy-4-(7H-purin-6-ylamino)cyclopentyl]-methylsulfamic acid |
| SMILES | CN([C@@H]1C[C@@H](Nc2ncnc3nc[nH]c23)[C@H](O)[C@@H]1O)S(=O)(=O)O |
| InChI | InChI=1S/C11H16N6O5S/c1-17(23(20,21)22)6-2-5(8(18)9(6)19)16-11-7-10(13-3-12-7)14-4-15-11/h3-6,8-9,18-19H,2H2,1H3,(H,20,21,22)(H2,12,13,14,15,16)/t5-,6-,8+,9-/m1/s1 |
| InChIKey | PXKBICJKXPYKHJ-MTSNSDSCSA-N |
| XLogP | -1.64 |
| TPSA | 164.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|