C10H8F3NO2 — CID 174698698
6-(trifluoromethyl)-2,4-dihydro-1H-3,1-benzoxazine-2-carbaldehyde (PubChem CID 174698698) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 6-(trifluoromethyl)-2,4-dihydro-1H-3,1-benzoxazine-2-carbaldehyde.
| Compound Name | 6-(trifluoromethyl)-2,4-dihydro-1H-3,1-benzoxazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174698698 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 6-(trifluoromethyl)-2,4-dihydro-1H-3,1-benzoxazine-2-carbaldehyde |
| SMILES | O=CC1Nc2ccc(C(F)(F)F)cc2CO1 |
| InChI | InChI=1S/C10H8F3NO2/c11-10(12,13)7-1-2-8-6(3-7)5-16-9(4-15)14-8/h1-4,9,14H,5H2 |
| InChIKey | CJJJNWRORNPFHO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|