C8F16O — CID 95054915
(5S)-2,2,3,3,4,4,5-heptafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane (PubChem CID 95054915) has the molecular formula C8F16O and a molecular weight of 416.06 g/mol. Its IUPAC name is (5S)-2,2,3,3,4,4,5-heptafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane.
| Compound Name | (5S)-2,2,3,3,4,4,5-heptafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane |
|---|---|
| PubChem CID | 95054915 |
| Molecular Formula | C8F16O |
| Molecular Weight | 416.06 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | (5S)-2,2,3,3,4,4,5-heptafluoro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxolane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)[C@@]1(F)OC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8F16O/c9-1(10,4(15,16)7(20,21)22)2(11,12)6(19)3(13,14)5(17,18)8(23,24)25-6/t6-/m1/s1 |
| InChIKey | FYJQJMIEZVMYSD-ZCFIWIBFSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.06 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|