C3H2Cl5F3Si — CID 23235528
trichloro-[(1S,2S)-1,2-dichloro-3,3,3-trifluoropropyl]silane (PubChem CID 23235528) has the molecular formula C3H2Cl5F3Si and a molecular weight of 300.39 g/mol. Its IUPAC name is trichloro-[(1S,2S)-1,2-dichloro-3,3,3-trifluoropropyl]silane.
| Compound Name | trichloro-[(1S,2S)-1,2-dichloro-3,3,3-trifluoropropyl]silane |
|---|---|
| PubChem CID | 23235528 |
| Molecular Formula | C3H2Cl5F3Si |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 297.83 |
| IUPAC Name | trichloro-[(1S,2S)-1,2-dichloro-3,3,3-trifluoropropyl]silane |
| SMILES | FC(F)(F)[C@H](Cl)[C@H](Cl)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C3H2Cl5F3Si/c4-1(3(9,10)11)2(5)12(6,7)8/h1-2H/t1-,2-/m1/s1 |
| InChIKey | UNYOKRBPWHYSJK-JCYAYHJZSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|