C9H15Cl4NOS — CID 57055577
S-(4,6,6,6-tetrachloro-3,3-dimethylhexyl) carbamothioate (PubChem CID 57055577) has the molecular formula C9H15Cl4NOS and a molecular weight of 327.10 g/mol. Its IUPAC name is S-(4,6,6,6-tetrachloro-3,3-dimethylhexyl) carbamothioate.
| Compound Name | S-(4,6,6,6-tetrachloro-3,3-dimethylhexyl) carbamothioate |
|---|---|
| PubChem CID | 57055577 |
| Molecular Formula | C9H15Cl4NOS |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | S-(4,6,6,6-tetrachloro-3,3-dimethylhexyl) carbamothioate |
| SMILES | CC(C)(CCSC(N)=O)C(Cl)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H15Cl4NOS/c1-8(2,3-4-16-7(14)15)6(10)5-9(11,12)13/h6H,3-5H2,1-2H3,(H2,14,15) |
| InChIKey | MGMLBVQFPFMWEU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|