C9H15NO8S — CID 146336175
3-(3-formamido-4-methoxy-4-oxobutan-2-yl)oxy-3-oxopropane-1-sulfonic acid (PubChem CID 146336175) has the molecular formula C9H15NO8S and a molecular weight of 297.29 g/mol. Its IUPAC name is 3-(3-formamido-4-methoxy-4-oxobutan-2-yl)oxy-3-oxopropane-1-sulfonic acid.
| Compound Name | 3-(3-formamido-4-methoxy-4-oxobutan-2-yl)oxy-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 146336175 |
| Molecular Formula | C9H15NO8S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-(3-formamido-4-methoxy-4-oxobutan-2-yl)oxy-3-oxopropane-1-sulfonic acid |
| SMILES | COC(=O)C(NC=O)C(C)OC(=O)CCS(=O)(=O)O |
| InChI | InChI=1S/C9H15NO8S/c1-6(8(10-5-11)9(13)17-2)18-7(12)3-4-19(14,15)16/h5-6,8H,3-4H2,1-2H3,(H,10,11)(H,14,15,16) |
| InChIKey | DYBFVYULLABMNK-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|