C12H21NO9S — CID 146336297
2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-sulfopropanoyloxy)butanoic acid (PubChem CID 146336297) has the molecular formula C12H21NO9S and a molecular weight of 355.37 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-sulfopropanoyloxy)butanoic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-sulfopropanoyloxy)butanoic acid |
|---|---|
| PubChem CID | 146336297 |
| Molecular Formula | C12H21NO9S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-sulfopropanoyloxy)butanoic acid |
| SMILES | CC(OC(=O)CCS(=O)(=O)O)C(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H21NO9S/c1-7(21-8(14)5-6-23(18,19)20)9(10(15)16)13-11(17)22-12(2,3)4/h7,9H,5-6H2,1-4H3,(H,13,17)(H,15,16)(H,18,19,20) |
| InChIKey | GTYSEKDEDILZKG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|