C10H13F3O2 — CID 167189028
(1,1,1-trifluoro-4-methylpent-3-en-2-yl) 2-methylprop-2-enoate (PubChem CID 167189028) has the molecular formula C10H13F3O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is (1,1,1-trifluoro-4-methylpent-3-en-2-yl) 2-methylprop-2-enoate.
| Compound Name | (1,1,1-trifluoro-4-methylpent-3-en-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167189028 |
| Molecular Formula | C10H13F3O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (1,1,1-trifluoro-4-methylpent-3-en-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H13F3O2/c1-6(2)5-8(10(11,12)13)15-9(14)7(3)4/h5,8H,3H2,1-2,4H3 |
| InChIKey | LQDYOTUZXDXBBM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|