C9H13FO4 — CID 86684661
2-fluoro-3-(2-methylprop-2-enoyloxy)pentanoic acid (PubChem CID 86684661) has the molecular formula C9H13FO4 and a molecular weight of 204.20 g/mol. Its IUPAC name is 2-fluoro-3-(2-methylprop-2-enoyloxy)pentanoic acid.
| Compound Name | 2-fluoro-3-(2-methylprop-2-enoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 86684661 |
| Molecular Formula | C9H13FO4 |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-fluoro-3-(2-methylprop-2-enoyloxy)pentanoic acid |
| SMILES | C=C(C)C(=O)OC(CC)C(F)C(=O)O |
| InChI | InChI=1S/C9H13FO4/c1-4-6(7(10)8(11)12)14-9(13)5(2)3/h6-7H,2,4H2,1,3H3,(H,11,12) |
| InChIKey | MFENLINPGHVFBL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|