C11H22O3Si — CID 173371342
2-dimethylsilyloxypentan-3-yl 2-methylprop-2-enoate (PubChem CID 173371342) has the molecular formula C11H22O3Si and a molecular weight of 230.38 g/mol. Its IUPAC name is 2-dimethylsilyloxypentan-3-yl 2-methylprop-2-enoate.
| Compound Name | 2-dimethylsilyloxypentan-3-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173371342 |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-dimethylsilyloxypentan-3-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)C(C)O[SiH](C)C |
| InChI | InChI=1S/C11H22O3Si/c1-7-10(9(4)14-15(5)6)13-11(12)8(2)3/h9-10,15H,2,7H2,1,3-6H3 |
| InChIKey | GEICZBZQXJJTTC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|