C10H14F5NO4S — CID 87415315
[2-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl] 2-methylprop-2-enoate (PubChem CID 87415315) has the molecular formula C10H14F5NO4S and a molecular weight of 339.28 g/mol. Its IUPAC name is [2-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87415315 |
| Molecular Formula | C10H14F5NO4S |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | [2-methyl-2-(1,1,2,2,2-pentafluoroethylsulfonylamino)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(C)NS(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H14F5NO4S/c1-6(2)7(17)20-5-8(3,4)16-21(18,19)10(14,15)9(11,12)13/h16H,1,5H2,2-4H3 |
| InChIKey | FDZFLXIWHVSYOG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|