C28H16F40N2O8S2 — CID 161157693
bis[1,1,2-trifluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)propan-2-yl] hexanedioate (PubChem CID 161157693) has the molecular formula C28H16F40N2O8S2 and a molecular weight of 1332.50 g/mol. Its IUPAC name is bis[1,1,2-trifluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)propan-2-yl] hexanedioate.
| Compound Name | bis[1,1,2-trifluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)propan-2-yl] hexanedioate |
|---|---|
| PubChem CID | 161157693 |
| Molecular Formula | C28H16F40N2O8S2 |
| Molecular Weight | 1332.50 g/mol |
| Exact Mass | 1331.97 |
| IUPAC Name | bis[1,1,2-trifluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)propan-2-yl] hexanedioate |
| SMILES | CC(F)(OC(=O)CCCCC(=O)OC(C)(F)C(F)(F)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C28H16F40N2O8S2/c1-9(29,25(61,62)69-79(73,74)27(65,66)21(51,52)17(43,44)13(35,36)11(31,32)15(39,40)19(47,48)23(55,56)57)77-7(71)5-3-4-6-8(72)78-10(2,30)26(63,64)70-80(75,76)28(67,68)22(53,54)18(45,46)14(37,38)12(33,34)16(41,42)20(49,50)24(58,59)60/h69-70H,3-6H2,1-2H3 |
| InChIKey | UPMXEUJSPNBJCY-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1332.50 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|