C15H31F5NO3S+ — CID 175529336
1,1,2,2,2-pentafluoroethyl pentane-1-sulfonate;tetraethylazanium (PubChem CID 175529336) has the molecular formula C15H31F5NO3S+ and a molecular weight of 400.47 g/mol. Its IUPAC name is 1,1,2,2,2-pentafluoroethyl pentane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,2-pentafluoroethyl pentane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 175529336 |
| Molecular Formula | C15H31F5NO3S+ |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1,1,2,2,2-pentafluoroethyl pentane-1-sulfonate;tetraethylazanium |
| SMILES | CCCCCS(=O)(=O)OC(F)(F)C(F)(F)F.CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C7H11F5O3S/c1-5-9(6-2,7-3)8-4;1-2-3-4-5-16(13,14)15-7(11,12)6(8,9)10/h5-8H2,1-4H3;2-5H2,1H3/q+1; |
| InChIKey | QHSJRVNCJJENGR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|