About potassium;fluoro nonane-1-sulfonate;hydride
potassium;fluoro nonane-1-sulfonate;hydride (PubChem CID 175529463) has the molecular formula C9H20FKO3S
and a molecular weight of 266.42 g/mol. Its IUPAC name is potassium;fluoro nonane-1-sulfonate;hydride.
Molecular Properties
| Compound Name | potassium;fluoro nonane-1-sulfonate;hydride |
| PubChem CID | 175529463 |
| Molecular Formula | C9H20FKO3S |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | potassium;fluoro nonane-1-sulfonate;hydride |
| SMILES | CCCCCCCCCS(=O)(=O)OF.[H-].[K+] |
| InChI | InChI=1S/C9H19FO3S.K.H/c1-2-3-4-5-6-7-8-9-14(11,12)13-10;;/h2-9H2,1H3;;/q;+1;-1 |
| InChIKey | CFFIFZYXHMXPLH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium;fluoro nonane-1-sulfonate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;fluoro nonane-1-sulfonate;hydride?
The IUPAC name of potassium;fluoro nonane-1-sulfonate;hydride (CID 175529463) is potassium;fluoro nonane-1-sulfonate;hydride.
What is the SMILES notation for potassium;fluoro nonane-1-sulfonate;hydride?
The canonical SMILES for potassium;fluoro nonane-1-sulfonate;hydride is CCCCCCCCCS(=O)(=O)OF.[H-].[K+].
What is the InChIKey of potassium;fluoro nonane-1-sulfonate;hydride?
The InChIKey is CFFIFZYXHMXPLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19FO3S.K.H/c1-2-3-4-5-6-7-8-9-14(11,12)13-10;;/h2-9H2,1H3;;/q;+1;-1.
What are the key properties of potassium;fluoro nonane-1-sulfonate;hydride?
potassium;fluoro nonane-1-sulfonate;hydride has a molecular weight of 266.42 g/mol, XLogP of 0.08, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;fluoro nonane-1-sulfonate;hydride is sourced from PubChem (CID 175529463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).